C17H23NO — CID 58782577
3,4-ditert-butyl-1H-quinolin-2-one (PubChem CID 58782577) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 3,4-ditert-butyl-1H-quinolin-2-one.
| Compound Name | 3,4-ditert-butyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 58782577 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 3,4-ditert-butyl-1H-quinolin-2-one |
| SMILES | CC(C)(C)c1c(C(C)(C)C)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C17H23NO/c1-16(2,3)13-11-9-7-8-10-12(11)18-15(19)14(13)17(4,5)6/h7-10H,1-6H3,(H,18,19) |
| InChIKey | YCWOANBKOKDKCZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |