C16H23N — CID 22374639
2,3-ditert-butyl-1H-indole (PubChem CID 22374639) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 2,3-ditert-butyl-1H-indole.
| Compound Name | 2,3-ditert-butyl-1H-indole |
|---|---|
| PubChem CID | 22374639 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2,3-ditert-butyl-1H-indole |
| SMILES | CC(C)(C)c1[nH]c2ccccc2c1C(C)(C)C |
| InChI | InChI=1S/C16H23N/c1-15(2,3)13-11-9-7-8-10-12(11)17-14(13)16(4,5)6/h7-10,17H,1-6H3 |
| InChIKey | HEUMZTLZXXILKC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |