C12H10N2O — CID 12529019
3-methyl-2,9-dihydropyrido[3,4-b]indol-1-one (PubChem CID 12529019) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-methyl-2,9-dihydropyrido[3,4-b]indol-1-one.
| Compound Name | 3-methyl-2,9-dihydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 12529019 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-methyl-2,9-dihydropyrido[3,4-b]indol-1-one |
| SMILES | Cc1cc2c([nH]c3ccccc32)c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N2O/c1-7-6-9-8-4-2-3-5-10(8)14-11(9)12(15)13-7/h2-6,14H,1H3,(H,13,15) |
| InChIKey | ALWGEQKCUIOXKQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |