C11H9NO2 — CID 15271398
3-methyl-2H-2-benzazepine-1,5-dione (PubChem CID 15271398) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-methyl-2H-2-benzazepine-1,5-dione.
| Compound Name | 3-methyl-2H-2-benzazepine-1,5-dione |
|---|---|
| PubChem CID | 15271398 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 3-methyl-2H-2-benzazepine-1,5-dione |
| SMILES | Cc1cc(=O)c2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H9NO2/c1-7-6-10(13)8-4-2-3-5-9(8)11(14)12-7/h2-6H,1H3,(H,12,14) |
| InChIKey | FEGUAANTVZSHQW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |