C12H16N2O — CID 142119860
2-methyl-1H-1,8-naphthyridin-4-one;propane (PubChem CID 142119860) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-methyl-1H-1,8-naphthyridin-4-one;propane.
| Compound Name | 2-methyl-1H-1,8-naphthyridin-4-one;propane |
|---|---|
| PubChem CID | 142119860 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-methyl-1H-1,8-naphthyridin-4-one;propane |
| SMILES | CCC.Cc1cc(=O)c2cccnc2[nH]1 |
| InChI | InChI=1S/C9H8N2O.C3H8/c1-6-5-8(12)7-3-2-4-10-9(7)11-6;1-3-2/h2-5H,1H3,(H,10,11,12);3H2,1-2H3 |
| InChIKey | PMMZICPGJMMIPW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |