C12H12N2O — CID 18946451
2,6-dimethyl-3-pyridin-2-yl-1H-pyridin-4-one (PubChem CID 18946451) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 2,6-dimethyl-3-pyridin-2-yl-1H-pyridin-4-one.
| Compound Name | 2,6-dimethyl-3-pyridin-2-yl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 18946451 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2,6-dimethyl-3-pyridin-2-yl-1H-pyridin-4-one |
| SMILES | Cc1cc(=O)c(-c2ccccn2)c(C)[nH]1 |
| InChI | InChI=1S/C12H12N2O/c1-8-7-11(15)12(9(2)14-8)10-5-3-4-6-13-10/h3-7H,1-2H3,(H,14,15) |
| InChIKey | VXEWSEWLZLCYIH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |