C12H9N3O — CID 82470815
6-methyl-2-oxo-4-pyridin-2-yl-1H-pyridine-3-carbonitrile (PubChem CID 82470815) has the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. Its IUPAC name is 6-methyl-2-oxo-4-pyridin-2-yl-1H-pyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-oxo-4-pyridin-2-yl-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82470815 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 6-methyl-2-oxo-4-pyridin-2-yl-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccccn2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C12H9N3O/c1-8-6-9(10(7-13)12(16)15-8)11-4-2-3-5-14-11/h2-6H,1H3,(H,15,16) |
| InChIKey | HKVOTJSBRMFWKT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |