C19H12N4O — CID 168585620
4-[4-(5-cyano-2-pyridinyl)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168585620) has the molecular formula C19H12N4O and a molecular weight of 312.33 g/mol. Its IUPAC name is 4-[4-(5-cyano-2-pyridinyl)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-[4-(5-cyano-2-pyridinyl)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168585620 |
| Molecular Formula | C19H12N4O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-[4-(5-cyano-2-pyridinyl)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccc(-c3ccc(C#N)cn3)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C19H12N4O/c1-12-8-16(17(10-21)19(24)23-12)14-3-5-15(6-4-14)18-7-2-13(9-20)11-22-18/h2-8,11H,1H3,(H,23,24) |
| InChIKey | YTCIBKYYDGVIHJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |