C20H16N2O2S — CID 168585767
6-methyl-4-[4-(2-methylsulfinylphenyl)phenyl]-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168585767) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 6-methyl-4-[4-(2-methylsulfinylphenyl)phenyl]-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-methyl-4-[4-(2-methylsulfinylphenyl)phenyl]-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168585767 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 6-methyl-4-[4-(2-methylsulfinylphenyl)phenyl]-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccc(-c3ccccc3S(C)=O)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C20H16N2O2S/c1-13-11-17(18(12-21)20(23)22-13)15-9-7-14(8-10-15)16-5-3-4-6-19(16)25(2)24/h3-11H,1-2H3,(H,22,23) |
| InChIKey | JOLUGAXGGUJSHT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |