C20H13F3N2O — CID 168585170
6-methyl-2-oxo-4-[2-[4-(trifluoromethyl)phenyl]phenyl]-1H-pyridine-3-carbonitrile (PubChem CID 168585170) has the molecular formula C20H13F3N2O and a molecular weight of 354.33 g/mol. Its IUPAC name is 6-methyl-2-oxo-4-[2-[4-(trifluoromethyl)phenyl]phenyl]-1H-pyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-oxo-4-[2-[4-(trifluoromethyl)phenyl]phenyl]-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168585170 |
| Molecular Formula | C20H13F3N2O |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 6-methyl-2-oxo-4-[2-[4-(trifluoromethyl)phenyl]phenyl]-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccccc2-c2ccc(C(F)(F)F)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C20H13F3N2O/c1-12-10-17(18(11-24)19(26)25-12)16-5-3-2-4-15(16)13-6-8-14(9-7-13)20(21,22)23/h2-10H,1H3,(H,25,26) |
| InChIKey | ADPQFVNYHCKLGF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |