C15H9F5N2O — CID 168585449
6-methyl-2-oxo-4-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-1H-pyridine-3-carbonitrile (PubChem CID 168585449) has the molecular formula C15H9F5N2O and a molecular weight of 328.24 g/mol. Its IUPAC name is 6-methyl-2-oxo-4-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-1H-pyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-oxo-4-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168585449 |
| Molecular Formula | C15H9F5N2O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 6-methyl-2-oxo-4-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccccc2C(F)(F)C(F)(F)F)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C15H9F5N2O/c1-8-6-10(11(7-21)13(23)22-8)9-4-2-3-5-12(9)14(16,17)15(18,19)20/h2-6H,1H3,(H,22,23) |
| InChIKey | QZVWCSGXLOXGSQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|