C14H8F3IN2O — CID 168585845
4-[4-iodo-2-(trifluoromethyl)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168585845) has the molecular formula C14H8F3IN2O and a molecular weight of 404.13 g/mol. Its IUPAC name is 4-[4-iodo-2-(trifluoromethyl)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-[4-iodo-2-(trifluoromethyl)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168585845 |
| Molecular Formula | C14H8F3IN2O |
| Molecular Weight | 404.13 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 4-[4-iodo-2-(trifluoromethyl)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccc(I)cc2C(F)(F)F)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C14H8F3IN2O/c1-7-4-10(11(6-19)13(21)20-7)9-3-2-8(18)5-12(9)14(15,16)17/h2-5H,1H3,(H,20,21) |
| InChIKey | LWARAOFXLROMEE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|