C13H8I2N2O2 — CID 168584564
4-(2-hydroxy-3,5-diiodophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168584564) has the molecular formula C13H8I2N2O2 and a molecular weight of 478.03 g/mol. Its IUPAC name is 4-(2-hydroxy-3,5-diiodophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(2-hydroxy-3,5-diiodophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168584564 |
| Molecular Formula | C13H8I2N2O2 |
| Molecular Weight | 478.03 g/mol |
| Exact Mass | 477.87 |
| IUPAC Name | 4-(2-hydroxy-3,5-diiodophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2cc(I)cc(I)c2O)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H8I2N2O2/c1-6-2-8(10(5-16)13(19)17-6)9-3-7(14)4-11(15)12(9)18/h2-4,18H,1H3,(H,17,19) |
| InChIKey | MEIIRRXQPDGYOE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.03 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|