C12H12N2O2 — CID 129448586
3-[(1S)-1-hydroxyethyl]-6-pyridin-2-yl-1H-pyridin-2-one (PubChem CID 129448586) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-[(1S)-1-hydroxyethyl]-6-pyridin-2-yl-1H-pyridin-2-one.
| Compound Name | 3-[(1S)-1-hydroxyethyl]-6-pyridin-2-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 129448586 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[(1S)-1-hydroxyethyl]-6-pyridin-2-yl-1H-pyridin-2-one |
| SMILES | C[C@H](O)c1ccc(-c2ccccn2)[nH]c1=O |
| InChI | InChI=1S/C12H12N2O2/c1-8(15)9-5-6-11(14-12(9)16)10-4-2-3-7-13-10/h2-8,15H,1H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | VYFKXRGATVQQNC-QMMMGPOBSA-N |
| XLogP | 1.49 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |