C18H22N4O2 — CID 125152328
3-[(2R)-2-[(1S)-1-aminoethyl]piperidine-1-carbonyl]-6-pyridin-2-yl-1H-pyridin-2-one (PubChem CID 125152328) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[(2R)-2-[(1S)-1-aminoethyl]piperidine-1-carbonyl]-6-pyridin-2-yl-1H-pyridin-2-one.
| Compound Name | 3-[(2R)-2-[(1S)-1-aminoethyl]piperidine-1-carbonyl]-6-pyridin-2-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 125152328 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-[(2R)-2-[(1S)-1-aminoethyl]piperidine-1-carbonyl]-6-pyridin-2-yl-1H-pyridin-2-one |
| SMILES | C[C@H](N)[C@H]1CCCCN1C(=O)c1ccc(-c2ccccn2)[nH]c1=O |
| InChI | InChI=1S/C18H22N4O2/c1-12(19)16-7-3-5-11-22(16)18(24)13-8-9-15(21-17(13)23)14-6-2-4-10-20-14/h2,4,6,8-10,12,16H,3,5,7,11,19H2,1H3,(H,21,23)/t12-,16+/m0/s1 |
| InChIKey | OBNHFYQGJPMYFQ-BLLLJJGKSA-N |
| XLogP | 1.78 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |