C20H23N3O2 — CID 94824320
3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-6-pyridin-2-yl-1H-pyridin-2-one (PubChem CID 94824320) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-6-pyridin-2-yl-1H-pyridin-2-one.
| Compound Name | 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-6-pyridin-2-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 94824320 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-6-pyridin-2-yl-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(-c2ccccn2)[nH]c1=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C20H23N3O2/c24-19-15(10-11-17(22-19)16-8-3-4-12-21-16)20(25)23-13-5-7-14-6-1-2-9-18(14)23/h3-4,8,10-12,14,18H,1-2,5-7,9,13H2,(H,22,24)/t14-,18-/m1/s1 |
| InChIKey | UWFGJOFIPMIUSO-RDTXWAMCSA-N |
| XLogP | 3.23 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |