C21H16N2O — CID 142993468
6-methyl-4-phenyl-3-pyridin-2-yl-1H-quinolin-2-one (PubChem CID 142993468) has the molecular formula C21H16N2O and a molecular weight of 312.37 g/mol. Its IUPAC name is 6-methyl-4-phenyl-3-pyridin-2-yl-1H-quinolin-2-one.
| Compound Name | 6-methyl-4-phenyl-3-pyridin-2-yl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142993468 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 6-methyl-4-phenyl-3-pyridin-2-yl-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)c(-c3ccccn3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H16N2O/c1-14-10-11-17-16(13-14)19(15-7-3-2-4-8-15)20(21(24)23-17)18-9-5-6-12-22-18/h2-13H,1H3,(H,23,24) |
| InChIKey | IYGKFQJVCQIDLQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |