C25H18BrNO2 — CID 2882181
3-[3-(4-bromophenyl)prop-2-enoyl]-6-methyl-4-phenyl-1H-quinolin-2-one (PubChem CID 2882181) has the molecular formula C25H18BrNO2 and a molecular weight of 444.33 g/mol. Its IUPAC name is 3-[3-(4-bromophenyl)prop-2-enoyl]-6-methyl-4-phenyl-1H-quinolin-2-one.
| Compound Name | 3-[3-(4-bromophenyl)prop-2-enoyl]-6-methyl-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 2882181 |
| Molecular Formula | C25H18BrNO2 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 3-[3-(4-bromophenyl)prop-2-enoyl]-6-methyl-4-phenyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)c(C(=O)C=Cc3ccc(Br)cc3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C25H18BrNO2/c1-16-7-13-21-20(15-16)23(18-5-3-2-4-6-18)24(25(29)27-21)22(28)14-10-17-8-11-19(26)12-9-17/h2-15H,1H3,(H,27,29) |
| InChIKey | VPOOTIZUKSQPMW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|