C17H14BrN3O — CID 135954546
6-bromo-3-ethanehydrazonoyl-4-phenyl-1H-quinolin-2-one (PubChem CID 135954546) has the molecular formula C17H14BrN3O and a molecular weight of 356.22 g/mol. Its IUPAC name is 6-bromo-3-ethanehydrazonoyl-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-bromo-3-ethanehydrazonoyl-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135954546 |
| Molecular Formula | C17H14BrN3O |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 6-bromo-3-ethanehydrazonoyl-4-phenyl-1H-quinolin-2-one |
| SMILES | C/C(=N/N)c1c(-c2ccccc2)c2cc(Br)ccc2[nH]c1=O |
| InChI | InChI=1S/C17H14BrN3O/c1-10(21-19)15-16(11-5-3-2-4-6-11)13-9-12(18)7-8-14(13)20-17(15)22/h2-9H,19H2,1H3,(H,20,22)/b21-10- |
| InChIKey | VEYLEJHLEIWGBG-FBHDLOMBSA-N |
| XLogP | 3.64 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|