C24H15BrClNO2 — CID 5345818
6-bromo-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (PubChem CID 5345818) has the molecular formula C24H15BrClNO2 and a molecular weight of 464.75 g/mol. Its IUPAC name is 6-bromo-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-bromo-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 5345818 |
| Molecular Formula | C24H15BrClNO2 |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 6-bromo-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)c1c(-c2ccccc2)c2cc(Br)ccc2[nH]c1=O |
| InChI | InChI=1S/C24H15BrClNO2/c25-17-11-12-20-18(14-17)22(16-7-2-1-3-8-16)23(24(29)27-20)21(28)13-10-15-6-4-5-9-19(15)26/h1-14H,(H,27,29)/b13-10+ |
| InChIKey | YGUVCDLHHYHWQO-JLHYYAGUSA-N |
| XLogP | 6.51 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|