C24H15Cl2NO2 — CID 2879879
6-chloro-3-[3-(2-chlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (PubChem CID 2879879) has the molecular formula C24H15Cl2NO2 and a molecular weight of 420.30 g/mol. Its IUPAC name is 6-chloro-3-[3-(2-chlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[3-(2-chlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 2879879 |
| Molecular Formula | C24H15Cl2NO2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 6-chloro-3-[3-(2-chlorophenyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| SMILES | O=C(C=Cc1ccccc1Cl)c1c(-c2ccccc2)c2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C24H15Cl2NO2/c25-17-11-12-20-18(14-17)22(16-7-2-1-3-8-16)23(24(29)27-20)21(28)13-10-15-6-4-5-9-19(15)26/h1-14H,(H,27,29) |
| InChIKey | CLLHXWPLNUTOQA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|