C23H14Cl2N2O2 — CID 134247975
6-chloro-3-[(E)-3-(5-chloro-3-pyridinyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one (PubChem CID 134247975) has the molecular formula C23H14Cl2N2O2 and a molecular weight of 421.28 g/mol. Its IUPAC name is 6-chloro-3-[(E)-3-(5-chloro-3-pyridinyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[(E)-3-(5-chloro-3-pyridinyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 134247975 |
| Molecular Formula | C23H14Cl2N2O2 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 6-chloro-3-[(E)-3-(5-chloro-3-pyridinyl)prop-2-enoyl]-4-phenyl-1H-quinolin-2-one |
| SMILES | O=C(/C=C/c1cncc(Cl)c1)c1c(-c2ccccc2)c2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C23H14Cl2N2O2/c24-16-7-8-19-18(11-16)21(15-4-2-1-3-5-15)22(23(29)27-19)20(28)9-6-14-10-17(25)13-26-12-14/h1-13H,(H,27,29)/b9-6+ |
| InChIKey | TUCSCKIGTGJKMQ-RMKNXTFCSA-N |
| XLogP | 5.79 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|