C22H14ClN3O2 — CID 140843187
6-chloro-4-phenyl-3-(3-pyrazin-2-ylprop-2-enoyl)-1H-quinolin-2-one (PubChem CID 140843187) has the molecular formula C22H14ClN3O2 and a molecular weight of 387.83 g/mol. Its IUPAC name is 6-chloro-4-phenyl-3-(3-pyrazin-2-ylprop-2-enoyl)-1H-quinolin-2-one.
| Compound Name | 6-chloro-4-phenyl-3-(3-pyrazin-2-ylprop-2-enoyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 140843187 |
| Molecular Formula | C22H14ClN3O2 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 6-chloro-4-phenyl-3-(3-pyrazin-2-ylprop-2-enoyl)-1H-quinolin-2-one |
| SMILES | O=C(C=Cc1cnccn1)c1c(-c2ccccc2)c2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C22H14ClN3O2/c23-15-6-8-18-17(12-15)20(14-4-2-1-3-5-14)21(22(28)26-18)19(27)9-7-16-13-24-10-11-25-16/h1-13H,(H,26,28) |
| InChIKey | FQKNRQPYWXXPJP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|