C23H13ClN4O2 — CID 134247920
5-[6-chloro-2-oxo-3-(3-pyridin-2-ylprop-2-enoyl)-1H-quinolin-4-yl]pyridine-3-carbonitrile (PubChem CID 134247920) has the molecular formula C23H13ClN4O2 and a molecular weight of 412.84 g/mol. Its IUPAC name is 5-[6-chloro-2-oxo-3-(3-pyridin-2-ylprop-2-enoyl)-1H-quinolin-4-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[6-chloro-2-oxo-3-(3-pyridin-2-ylprop-2-enoyl)-1H-quinolin-4-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134247920 |
| Molecular Formula | C23H13ClN4O2 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 5-[6-chloro-2-oxo-3-(3-pyridin-2-ylprop-2-enoyl)-1H-quinolin-4-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(-c2c(C(=O)C=Cc3ccccn3)c(=O)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C23H13ClN4O2/c24-16-4-6-19-18(10-16)21(15-9-14(11-25)12-26-13-15)22(23(30)28-19)20(29)7-5-17-3-1-2-8-27-17/h1-10,12-13H,(H,28,30) |
| InChIKey | JUYYMBCPGXFCDI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|