C23H15FN2O2 — CID 153281790
4-(4-fluorophenyl)-3-[(E)-3-pyridin-2-ylprop-2-enoyl]-1H-quinolin-2-one (PubChem CID 153281790) has the molecular formula C23H15FN2O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-[(E)-3-pyridin-2-ylprop-2-enoyl]-1H-quinolin-2-one.
| Compound Name | 4-(4-fluorophenyl)-3-[(E)-3-pyridin-2-ylprop-2-enoyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 153281790 |
| Molecular Formula | C23H15FN2O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-(4-fluorophenyl)-3-[(E)-3-pyridin-2-ylprop-2-enoyl]-1H-quinolin-2-one |
| SMILES | O=C(/C=C/c1ccccn1)c1c(-c2ccc(F)cc2)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C23H15FN2O2/c24-16-10-8-15(9-11-16)21-18-6-1-2-7-19(18)26-23(28)22(21)20(27)13-12-17-5-3-4-14-25-17/h1-14H,(H,26,28)/b13-12+ |
| InChIKey | OAKOVENJQUMSSP-OUKQBFOZSA-N |
| XLogP | 4.63 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|