About 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one
6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one (PubChem CID 136920119) has the molecular formula C24H17BrN2O2
and a molecular weight of 445.32 g/mol. Its IUPAC name is 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one |
| PubChem CID | 136920119 |
| Molecular Formula | C24H17BrN2O2 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccc(Br)cc2c(-c2ccccc2)c1C1=NO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C24H17BrN2O2/c25-17-11-12-19-18(13-17)22(16-9-5-2-6-10-16)23(24(28)26-19)20-14-21(29-27-20)15-7-3-1-4-8-15/h1-13,21H,14H2,(H,26,28)/t21-/m1/s1 |
| InChIKey | ZXLPPLNAHIWTJQ-OAQYLSRUSA-N |
| XLogP | 5.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one?
The IUPAC name of 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one (CID 136920119) is 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one.
What is the SMILES notation for 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one?
The canonical SMILES for 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one is O=c1[nH]c2ccc(Br)cc2c(-c2ccccc2)c1C1=NO[C@@H](c2ccccc2)C1.
What is the InChIKey of 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one?
The InChIKey is ZXLPPLNAHIWTJQ-OAQYLSRUSA-N. The full InChI is InChI=1S/C24H17BrN2O2/c25-17-11-12-19-18(13-17)22(16-9-5-2-6-10-16)23(24(28)26-19)20-14-21(29-27-20)15-7-3-1-4-8-15/h1-13,21H,14H2,(H,26,28)/t21-/m1/s1.
What are the key properties of 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one?
6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one has a molecular weight of 445.32 g/mol, XLogP of 5.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-phenyl-3-[(5R)-5-phenyl-4,5-dihydro-1,2-oxazol-3-yl]-1H-quinolin-2-one is sourced from PubChem (CID 136920119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).