C49H37N — CID 153429686
2-[3-[2-(3,5-dimethylphenyl)-3,4,5,6-tetraphenylphenyl]phenyl]pyridine (PubChem CID 153429686) has the molecular formula C49H37N and a molecular weight of 639.84 g/mol. Its IUPAC name is 2-[3-[2-(3,5-dimethylphenyl)-3,4,5,6-tetraphenylphenyl]phenyl]pyridine.
| Compound Name | 2-[3-[2-(3,5-dimethylphenyl)-3,4,5,6-tetraphenylphenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 153429686 |
| Molecular Formula | C49H37N |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.29 |
| IUPAC Name | 2-[3-[2-(3,5-dimethylphenyl)-3,4,5,6-tetraphenylphenyl]phenyl]pyridine |
| SMILES | Cc1cc(C)cc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2-c2cccc(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C49H37N/c1-34-30-35(2)32-42(31-34)49-47(39-24-13-6-14-25-39)45(37-20-9-4-10-21-37)44(36-18-7-3-8-19-36)46(38-22-11-5-12-23-38)48(49)41-27-17-26-40(33-41)43-28-15-16-29-50-43/h3-33H,1-2H3 |
| InChIKey | RYDNDFQLALCRAE-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |