C40H29N3 — CID 132567607
4-(2,3,6-triphenyl-4,5-dipyridin-2-ylphenyl)aniline (PubChem CID 132567607) has the molecular formula C40H29N3 and a molecular weight of 551.69 g/mol. Its IUPAC name is 4-(2,3,6-triphenyl-4,5-dipyridin-2-ylphenyl)aniline.
| Compound Name | 4-(2,3,6-triphenyl-4,5-dipyridin-2-ylphenyl)aniline |
|---|---|
| PubChem CID | 132567607 |
| Molecular Formula | C40H29N3 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 4-(2,3,6-triphenyl-4,5-dipyridin-2-ylphenyl)aniline |
| SMILES | Nc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccn3)c(-c3ccccn3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H29N3/c41-32-24-22-31(23-25-32)36-35(28-14-4-1-5-15-28)37(29-16-6-2-7-17-29)39(33-20-10-12-26-42-33)40(34-21-11-13-27-43-34)38(36)30-18-8-3-9-19-30/h1-27H,41H2 |
| InChIKey | RQGBBNBEFXHNLO-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|