C18H16N2 — CID 118652406
2-(2,5-dimethyl-4-pyridin-2-ylphenyl)pyridine (PubChem CID 118652406) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(2,5-dimethyl-4-pyridin-2-ylphenyl)pyridine.
| Compound Name | 2-(2,5-dimethyl-4-pyridin-2-ylphenyl)pyridine |
|---|---|
| PubChem CID | 118652406 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(2,5-dimethyl-4-pyridin-2-ylphenyl)pyridine |
| SMILES | Cc1cc(-c2ccccn2)c(C)cc1-c1ccccn1 |
| InChI | InChI=1S/C18H16N2/c1-13-11-16(18-8-4-6-10-20-18)14(2)12-15(13)17-7-3-5-9-19-17/h3-12H,1-2H3 |
| InChIKey | XEQNAWCXAPVJTE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |