C15H19N — CID 143636710
2-(2,4-dimethylphenyl)pyridine;ethane (PubChem CID 143636710) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)pyridine;ethane.
| Compound Name | 2-(2,4-dimethylphenyl)pyridine;ethane |
|---|---|
| PubChem CID | 143636710 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-(2,4-dimethylphenyl)pyridine;ethane |
| SMILES | CC.Cc1ccc(-c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C13H13N.C2H6/c1-10-6-7-12(11(2)9-10)13-5-3-4-8-14-13;1-2/h3-9H,1-2H3;1-2H3 |
| InChIKey | PMZVUVZKSJIMFA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |