C14H15F2N — CID 145481986
2-(4,5-difluoro-2-methylphenyl)pyridine;ethane (PubChem CID 145481986) has the molecular formula C14H15F2N and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(4,5-difluoro-2-methylphenyl)pyridine;ethane.
| Compound Name | 2-(4,5-difluoro-2-methylphenyl)pyridine;ethane |
|---|---|
| PubChem CID | 145481986 |
| Molecular Formula | C14H15F2N |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(4,5-difluoro-2-methylphenyl)pyridine;ethane |
| SMILES | CC.Cc1cc(F)c(F)cc1-c1ccccn1 |
| InChI | InChI=1S/C12H9F2N.C2H6/c1-8-6-10(13)11(14)7-9(8)12-4-2-3-5-15-12;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | UNZDYDDLECOBCF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |