C12H9F2N — CID 170974832
2-(2,5-difluoro-4-methylphenyl)pyridine (PubChem CID 170974832) has the molecular formula C12H9F2N and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(2,5-difluoro-4-methylphenyl)pyridine.
| Compound Name | 2-(2,5-difluoro-4-methylphenyl)pyridine |
|---|---|
| PubChem CID | 170974832 |
| Molecular Formula | C12H9F2N |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(2,5-difluoro-4-methylphenyl)pyridine |
| SMILES | Cc1cc(F)c(-c2ccccn2)cc1F |
| InChI | InChI=1S/C12H9F2N/c1-8-6-11(14)9(7-10(8)13)12-4-2-3-5-15-12/h2-7H,1H3 |
| InChIKey | JZSYUKGWUNSCNF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |