C20H13ClFN3 — CID 59631148
4-chloro-7-fluoro-3-methyl-2,6-dipyridin-2-ylquinoline (PubChem CID 59631148) has the molecular formula C20H13ClFN3 and a molecular weight of 349.80 g/mol. Its IUPAC name is 4-chloro-7-fluoro-3-methyl-2,6-dipyridin-2-ylquinoline.
| Compound Name | 4-chloro-7-fluoro-3-methyl-2,6-dipyridin-2-ylquinoline |
|---|---|
| PubChem CID | 59631148 |
| Molecular Formula | C20H13ClFN3 |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-chloro-7-fluoro-3-methyl-2,6-dipyridin-2-ylquinoline |
| SMILES | Cc1c(-c2ccccn2)nc2cc(F)c(-c3ccccn3)cc2c1Cl |
| InChI | InChI=1S/C20H13ClFN3/c1-12-19(21)14-10-13(16-6-2-4-8-23-16)15(22)11-18(14)25-20(12)17-7-3-5-9-24-17/h2-11H,1H3 |
| InChIKey | VXHGHHCYUXQZPA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |