C17H13FN2 — CID 59631216
4-ethenyl-7-fluoro-3-methyl-2-pyridin-2-ylquinoline (PubChem CID 59631216) has the molecular formula C17H13FN2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-ethenyl-7-fluoro-3-methyl-2-pyridin-2-ylquinoline.
| Compound Name | 4-ethenyl-7-fluoro-3-methyl-2-pyridin-2-ylquinoline |
|---|---|
| PubChem CID | 59631216 |
| Molecular Formula | C17H13FN2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-ethenyl-7-fluoro-3-methyl-2-pyridin-2-ylquinoline |
| SMILES | C=Cc1c(C)c(-c2ccccn2)nc2cc(F)ccc12 |
| InChI | InChI=1S/C17H13FN2/c1-3-13-11(2)17(15-6-4-5-9-19-15)20-16-10-12(18)7-8-14(13)16/h3-10H,1H2,2H3 |
| InChIKey | IRCFCHUQAROOMZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |