C16H9ClF2N2 — CID 90095092
2-(5-chloro-2,4-difluorophenyl)-3-pyridin-2-ylpyridine (PubChem CID 90095092) has the molecular formula C16H9ClF2N2 and a molecular weight of 302.71 g/mol. Its IUPAC name is 2-(5-chloro-2,4-difluorophenyl)-3-pyridin-2-ylpyridine.
| Compound Name | 2-(5-chloro-2,4-difluorophenyl)-3-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 90095092 |
| Molecular Formula | C16H9ClF2N2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-(5-chloro-2,4-difluorophenyl)-3-pyridin-2-ylpyridine |
| SMILES | Fc1cc(F)c(-c2ncccc2-c2ccccn2)cc1Cl |
| InChI | InChI=1S/C16H9ClF2N2/c17-12-8-11(13(18)9-14(12)19)16-10(4-3-7-21-16)15-5-1-2-6-20-15/h1-9H |
| InChIKey | UZRYDDMXAPSTOP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|