About 2-(2,4-difluorophenyl)pyridine;trichloroiridium
2-(2,4-difluorophenyl)pyridine;trichloroiridium (PubChem CID 174879451) has the molecular formula C11H7Cl3F2IrN
and a molecular weight of 489.76 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)pyridine;trichloroiridium.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)pyridine;trichloroiridium |
| PubChem CID | 174879451 |
| Molecular Formula | C11H7Cl3F2IrN |
| Molecular Weight | 489.76 g/mol |
| Exact Mass | 488.92 |
| IUPAC Name | 2-(2,4-difluorophenyl)pyridine;trichloroiridium |
| SMILES | Cl[Ir](Cl)Cl.Fc1ccc(-c2ccccn2)c(F)c1 |
| InChI | InChI=1S/C11H7F2N.3ClH.Ir/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;;;;/h1-7H;3*1H;/q;;;;+3/p-3 |
| InChIKey | HLUUBASSNHZNMJ-UHFFFAOYSA-K |
| XLogP | 5.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.76 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,4-difluorophenyl)pyridine;trichloroiridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)pyridine;trichloroiridium?
The IUPAC name of 2-(2,4-difluorophenyl)pyridine;trichloroiridium (CID 174879451) is 2-(2,4-difluorophenyl)pyridine;trichloroiridium.
What is the SMILES notation for 2-(2,4-difluorophenyl)pyridine;trichloroiridium?
The canonical SMILES for 2-(2,4-difluorophenyl)pyridine;trichloroiridium is Cl[Ir](Cl)Cl.Fc1ccc(-c2ccccn2)c(F)c1.
What is the InChIKey of 2-(2,4-difluorophenyl)pyridine;trichloroiridium?
The InChIKey is HLUUBASSNHZNMJ-UHFFFAOYSA-K. The full InChI is InChI=1S/C11H7F2N.3ClH.Ir/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;;;;/h1-7H;3*1H;/q;;;;+3/p-3.
What are the key properties of 2-(2,4-difluorophenyl)pyridine;trichloroiridium?
2-(2,4-difluorophenyl)pyridine;trichloroiridium has a molecular weight of 489.76 g/mol, XLogP of 5.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)pyridine;trichloroiridium is sourced from PubChem (CID 174879451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).