C17H12F2N2 — CID 158927077
2-(2,4-difluorophenyl)-6-(pyridin-2-ylmethyl)pyridine (PubChem CID 158927077) has the molecular formula C17H12F2N2 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-6-(pyridin-2-ylmethyl)pyridine.
| Compound Name | 2-(2,4-difluorophenyl)-6-(pyridin-2-ylmethyl)pyridine |
|---|---|
| PubChem CID | 158927077 |
| Molecular Formula | C17H12F2N2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(2,4-difluorophenyl)-6-(pyridin-2-ylmethyl)pyridine |
| SMILES | Fc1ccc(-c2cccc(Cc3ccccn3)n2)c(F)c1 |
| InChI | InChI=1S/C17H12F2N2/c18-12-7-8-15(16(19)10-12)17-6-3-5-14(21-17)11-13-4-1-2-9-20-13/h1-10H,11H2 |
| InChIKey | KUFBSFJMSBVMFS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |