C16H8F4N2 — CID 58640778
2-[6-(2,4-difluorophenyl)-2-pyridinyl]-3,5-difluoropyridine (PubChem CID 58640778) has the molecular formula C16H8F4N2 and a molecular weight of 304.25 g/mol. Its IUPAC name is 2-[6-(2,4-difluorophenyl)-2-pyridinyl]-3,5-difluoropyridine.
| Compound Name | 2-[6-(2,4-difluorophenyl)-2-pyridinyl]-3,5-difluoropyridine |
|---|---|
| PubChem CID | 58640778 |
| Molecular Formula | C16H8F4N2 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[6-(2,4-difluorophenyl)-2-pyridinyl]-3,5-difluoropyridine |
| SMILES | Fc1ccc(-c2cccc(-c3ncc(F)cc3F)n2)c(F)c1 |
| InChI | InChI=1S/C16H8F4N2/c17-9-4-5-11(12(19)6-9)14-2-1-3-15(22-14)16-13(20)7-10(18)8-21-16/h1-8H |
| InChIKey | MWBYNGIWEMGYAI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |