About 2-(2,4-difluorophenyl)-5-fluoropyridine
2-(2,4-difluorophenyl)-5-fluoropyridine (PubChem CID 130334925) has the molecular formula C11H6F3N
and a molecular weight of 209.17 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-5-fluoropyridine.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)-5-fluoropyridine |
| PubChem CID | 130334925 |
| Molecular Formula | C11H6F3N |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-(2,4-difluorophenyl)-5-fluoropyridine |
| SMILES | Fc1ccc(-c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C11H6F3N/c12-7-1-3-9(10(14)5-7)11-4-2-8(13)6-15-11/h1-6H |
| InChIKey | RKUQBAQVAGDVEX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,4-difluorophenyl)-5-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)-5-fluoropyridine?
The IUPAC name of 2-(2,4-difluorophenyl)-5-fluoropyridine (CID 130334925) is 2-(2,4-difluorophenyl)-5-fluoropyridine.
What is the SMILES notation for 2-(2,4-difluorophenyl)-5-fluoropyridine?
The canonical SMILES for 2-(2,4-difluorophenyl)-5-fluoropyridine is Fc1ccc(-c2ccc(F)cc2F)nc1.
What is the InChIKey of 2-(2,4-difluorophenyl)-5-fluoropyridine?
The InChIKey is RKUQBAQVAGDVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F3N/c12-7-1-3-9(10(14)5-7)11-4-2-8(13)6-15-11/h1-6H.
What are the key properties of 2-(2,4-difluorophenyl)-5-fluoropyridine?
2-(2,4-difluorophenyl)-5-fluoropyridine has a molecular weight of 209.17 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)-5-fluoropyridine is sourced from PubChem (CID 130334925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).