C35H34F4IrN4+3 — CID 161458309
bis(2-(2,4-difluorophenyl)pyridine);N,N'-di(propan-2-yl)benzenecarboximidamide;iridium(3+) (PubChem CID 161458309) has the molecular formula C35H34F4IrN4+3 and a molecular weight of 778.89 g/mol. Its IUPAC name is bis(2-(2,4-difluorophenyl)pyridine);N,N'-di(propan-2-yl)benzenecarboximidamide;iridium(3+).
| Compound Name | bis(2-(2,4-difluorophenyl)pyridine);N,N'-di(propan-2-yl)benzenecarboximidamide;iridium(3+) |
|---|---|
| PubChem CID | 161458309 |
| Molecular Formula | C35H34F4IrN4+3 |
| Molecular Weight | 778.89 g/mol |
| Exact Mass | 779.23 |
| IUPAC Name | bis(2-(2,4-difluorophenyl)pyridine);N,N'-di(propan-2-yl)benzenecarboximidamide;iridium(3+) |
| SMILES | CC(C)/N=C(/NC(C)C)c1ccccc1.Fc1ccc(-c2ccccn2)c(F)c1.Fc1ccc(-c2ccccn2)c(F)c1.[Ir+3] |
| InChI | InChI=1S/C13H20N2.2C11H7F2N.Ir/c1-10(2)14-13(15-11(3)4)12-8-6-5-7-9-12;2*12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h5-11H,1-4H3,(H,14,15);2*1-7H;/q;;;+3 |
| InChIKey | WBLOJAAFHAPKNS-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.89 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|