C13H11F2NO — CID 143762249
1-[6-(2,4-difluorophenyl)-3-pyridinyl]ethanol (PubChem CID 143762249) has the molecular formula C13H11F2NO and a molecular weight of 235.23 g/mol. Its IUPAC name is 1-[6-(2,4-difluorophenyl)-3-pyridinyl]ethanol.
| Compound Name | 1-[6-(2,4-difluorophenyl)-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 143762249 |
| Molecular Formula | C13H11F2NO |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1-[6-(2,4-difluorophenyl)-3-pyridinyl]ethanol |
| SMILES | CC(O)c1ccc(-c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C13H11F2NO/c1-8(17)9-2-5-13(16-7-9)11-4-3-10(14)6-12(11)15/h2-8,17H,1H3 |
| InChIKey | FGSPRNGCXJCYPS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |