C15H12F3NO — CID 21406754
2-[4-(2,4-difluorophenyl)-3-fluorophenyl]propanamide (PubChem CID 21406754) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenyl)-3-fluorophenyl]propanamide.
| Compound Name | 2-[4-(2,4-difluorophenyl)-3-fluorophenyl]propanamide |
|---|---|
| PubChem CID | 21406754 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[4-(2,4-difluorophenyl)-3-fluorophenyl]propanamide |
| SMILES | CC(C(N)=O)c1ccc(-c2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C15H12F3NO/c1-8(15(19)20)9-2-4-11(13(17)6-9)12-5-3-10(16)7-14(12)18/h2-8H,1H3,(H2,19,20) |
| InChIKey | PVSTVTHLHHXVIU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |