C15H11ClF2O2 — CID 21406779
2-[3-chloro-4-(2,4-difluorophenyl)phenyl]propanoic acid (PubChem CID 21406779) has the molecular formula C15H11ClF2O2 and a molecular weight of 296.70 g/mol. Its IUPAC name is 2-[3-chloro-4-(2,4-difluorophenyl)phenyl]propanoic acid.
| Compound Name | 2-[3-chloro-4-(2,4-difluorophenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 21406779 |
| Molecular Formula | C15H11ClF2O2 |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-[3-chloro-4-(2,4-difluorophenyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(-c2ccc(F)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClF2O2/c1-8(15(19)20)9-2-4-11(13(16)6-9)12-5-3-10(17)7-14(12)18/h2-8H,1H3,(H,19,20) |
| InChIKey | BUHPBRUKRHNVKB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |