C15H11FO6S2 — CID 54323540
2-(7-fluoro-5,5,10,10-tetraoxothianthren-2-yl)propanoic acid (PubChem CID 54323540) has the molecular formula C15H11FO6S2 and a molecular weight of 370.38 g/mol. Its IUPAC name is 2-(7-fluoro-5,5,10,10-tetraoxothianthren-2-yl)propanoic acid.
| Compound Name | 2-(7-fluoro-5,5,10,10-tetraoxothianthren-2-yl)propanoic acid |
|---|---|
| PubChem CID | 54323540 |
| Molecular Formula | C15H11FO6S2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-(7-fluoro-5,5,10,10-tetraoxothianthren-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(c1)S(=O)(=O)c1ccc(F)cc1S2(=O)=O |
| InChI | InChI=1S/C15H11FO6S2/c1-8(15(17)18)9-2-4-11-13(6-9)23(19,20)12-5-3-10(16)7-14(12)24(11,21)22/h2-8H,1H3,(H,17,18) |
| InChIKey | STICBEJWVAKIAV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |