C16H13FO3S — CID 54557701
2-(7-fluoro-10-oxo-9H-thioxanthen-2-yl)propanoic acid (PubChem CID 54557701) has the molecular formula C16H13FO3S and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-(7-fluoro-10-oxo-9H-thioxanthen-2-yl)propanoic acid.
| Compound Name | 2-(7-fluoro-10-oxo-9H-thioxanthen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 54557701 |
| Molecular Formula | C16H13FO3S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(7-fluoro-10-oxo-9H-thioxanthen-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(c1)Cc1cc(F)ccc1S2=O |
| InChI | InChI=1S/C16H13FO3S/c1-9(16(18)19)10-2-4-14-11(6-10)7-12-8-13(17)3-5-15(12)21(14)20/h2-6,8-9H,7H2,1H3,(H,18,19) |
| InChIKey | ZOHXYKILJIUAQF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |