C13H12F2N2 — CID 67473570
3-(2,4-difluorophenyl)-6-propan-2-ylpyridazine (PubChem CID 67473570) has the molecular formula C13H12F2N2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-6-propan-2-ylpyridazine.
| Compound Name | 3-(2,4-difluorophenyl)-6-propan-2-ylpyridazine |
|---|---|
| PubChem CID | 67473570 |
| Molecular Formula | C13H12F2N2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-(2,4-difluorophenyl)-6-propan-2-ylpyridazine |
| SMILES | CC(C)c1ccc(-c2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C13H12F2N2/c1-8(2)12-5-6-13(17-16-12)10-4-3-9(14)7-11(10)15/h3-8H,1-2H3 |
| InChIKey | OBUKNLDPAVZOSF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |