C12H15F2N3Si — CID 166520408
[4-(2,4-difluorophenyl)triazol-1-yl]methyl-trimethylsilane (PubChem CID 166520408) has the molecular formula C12H15F2N3Si and a molecular weight of 267.36 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)triazol-1-yl]methyl-trimethylsilane.
| Compound Name | [4-(2,4-difluorophenyl)triazol-1-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 166520408 |
| Molecular Formula | C12H15F2N3Si |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | [4-(2,4-difluorophenyl)triazol-1-yl]methyl-trimethylsilane |
| SMILES | C[Si](C)(C)Cn1cc(-c2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C12H15F2N3Si/c1-18(2,3)8-17-7-12(15-16-17)10-5-4-9(13)6-11(10)14/h4-7H,8H2,1-3H3 |
| InChIKey | SMKBXBZTTDQSLH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|