C12H16F2N4Si — CID 162785925
[4-[5-(difluoromethyl)-2-pyridinyl]triazol-1-yl]methyl-trimethylsilane (PubChem CID 162785925) has the molecular formula C12H16F2N4Si and a molecular weight of 282.37 g/mol. Its IUPAC name is [4-[5-(difluoromethyl)-2-pyridinyl]triazol-1-yl]methyl-trimethylsilane.
| Compound Name | [4-[5-(difluoromethyl)-2-pyridinyl]triazol-1-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 162785925 |
| Molecular Formula | C12H16F2N4Si |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [4-[5-(difluoromethyl)-2-pyridinyl]triazol-1-yl]methyl-trimethylsilane |
| SMILES | C[Si](C)(C)Cn1cc(-c2ccc(C(F)F)cn2)nn1 |
| InChI | InChI=1S/C12H16F2N4Si/c1-19(2,3)8-18-7-11(16-17-18)10-5-4-9(6-15-10)12(13)14/h4-7,12H,8H2,1-3H3 |
| InChIKey | VRUOYRAGNNHVLB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|