C14H18N4O3 — CID 166263679
ethyl (3S)-3-hydroxy-4-[4-(5-methyl-2-pyridinyl)triazol-1-yl]butanoate (PubChem CID 166263679) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl (3S)-3-hydroxy-4-[4-(5-methyl-2-pyridinyl)triazol-1-yl]butanoate.
| Compound Name | ethyl (3S)-3-hydroxy-4-[4-(5-methyl-2-pyridinyl)triazol-1-yl]butanoate |
|---|---|
| PubChem CID | 166263679 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | ethyl (3S)-3-hydroxy-4-[4-(5-methyl-2-pyridinyl)triazol-1-yl]butanoate |
| SMILES | CCOC(=O)C[C@H](O)Cn1cc(-c2ccc(C)cn2)nn1 |
| InChI | InChI=1S/C14H18N4O3/c1-3-21-14(20)6-11(19)8-18-9-13(16-17-18)12-5-4-10(2)7-15-12/h4-5,7,9,11,19H,3,6,8H2,1-2H3/t11-/m0/s1 |
| InChIKey | TULVQKVTGHZHJY-NSHDSACASA-N |
| XLogP | 0.96 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |