C11H13N3O2 — CID 134693308
2-[4-(4-methylphenyl)triazol-1-yl]ethane-1,1-diol (PubChem CID 134693308) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)triazol-1-yl]ethane-1,1-diol.
| Compound Name | 2-[4-(4-methylphenyl)triazol-1-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 134693308 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-[4-(4-methylphenyl)triazol-1-yl]ethane-1,1-diol |
| SMILES | Cc1ccc(-c2cn(CC(O)O)nn2)cc1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-2-4-9(5-3-8)10-6-14(13-12-10)7-11(15)16/h2-6,11,15-16H,7H2,1H3 |
| InChIKey | YFBWHGIFSSTSBA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|